About 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine
4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine (PubChem CID 144810688) has the molecular formula C10H18N4O3
and a molecular weight of 242.28 g/mol. Its IUPAC name is 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine.
Molecular Properties
| Compound Name | 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine |
| PubChem CID | 144810688 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine |
| SMILES | CNC.CNC(=O)c1c(OC)ncnc1OC |
| InChI | InChI=1S/C8H11N3O3.C2H7N/c1-9-6(12)5-7(13-2)10-4-11-8(5)14-3;1-3-2/h4H,1-3H3,(H,9,12);3H,1-2H3 |
| InChIKey | VHFJFPZRQOQZFI-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine?
The IUPAC name of 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine (CID 144810688) is 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine.
What is the SMILES notation for 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine?
The canonical SMILES for 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine is CNC.CNC(=O)c1c(OC)ncnc1OC.
What is the InChIKey of 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine?
The InChIKey is VHFJFPZRQOQZFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3.C2H7N/c1-9-6(12)5-7(13-2)10-4-11-8(5)14-3;1-3-2/h4H,1-3H3,(H,9,12);3H,1-2H3.
What are the key properties of 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine?
4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine has a molecular weight of 242.28 g/mol, XLogP of -0.31, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-N-methylpyrimidine-5-carboxamide;N-methylmethanamine is sourced from PubChem (CID 144810688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).