C19H23FN2O — CID 144810708
8-fluoro-2-[(3E)-hexa-1,3,5-trien-3-yl]-3-propylisoquinolin-1-one;methanamine (PubChem CID 144810708) has the molecular formula C19H23FN2O and a molecular weight of 314.40 g/mol. Its IUPAC name is 8-fluoro-2-[(3E)-hexa-1,3,5-trien-3-yl]-3-propylisoquinolin-1-one;methanamine.
| Compound Name | 8-fluoro-2-[(3E)-hexa-1,3,5-trien-3-yl]-3-propylisoquinolin-1-one;methanamine |
|---|---|
| PubChem CID | 144810708 |
| Molecular Formula | C19H23FN2O |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 8-fluoro-2-[(3E)-hexa-1,3,5-trien-3-yl]-3-propylisoquinolin-1-one;methanamine |
| SMILES | C=C/C=C(\C=C)n1c(CCC)cc2cccc(F)c2c1=O.CN |
| InChI | InChI=1S/C18H18FNO.CH5N/c1-4-8-14(6-3)20-15(9-5-2)12-13-10-7-11-16(19)17(13)18(20)21;1-2/h4,6-8,10-12H,1,3,5,9H2,2H3;2H2,1H3/b14-8+; |
| InChIKey | GGCSZUDVIWYNJH-XHIXCECLSA-N |
| XLogP | 3.88 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|