C18H31N3O — CID 144811713
ethane;methane;1-(1-methylindazol-5-yl)-3-pyrrolidin-1-ylpropan-1-ol (PubChem CID 144811713) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is ethane;methane;1-(1-methylindazol-5-yl)-3-pyrrolidin-1-ylpropan-1-ol.
| Compound Name | ethane;methane;1-(1-methylindazol-5-yl)-3-pyrrolidin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 144811713 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | ethane;methane;1-(1-methylindazol-5-yl)-3-pyrrolidin-1-ylpropan-1-ol |
| SMILES | C.CC.Cn1ncc2cc(C(O)CCN3CCCC3)ccc21 |
| InChI | InChI=1S/C15H21N3O.C2H6.CH4/c1-17-14-5-4-12(10-13(14)11-16-17)15(19)6-9-18-7-2-3-8-18;1-2;/h4-5,10-11,15,19H,2-3,6-9H2,1H3;1-2H3;1H4 |
| InChIKey | BMAOQMQODOSNDM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |