C16H26N2O3 — CID 144811822
1-[4,5-dimethoxy-2-(methylamino)phenyl]-3-pyrrolidin-1-ylpropan-1-ol (PubChem CID 144811822) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[4,5-dimethoxy-2-(methylamino)phenyl]-3-pyrrolidin-1-ylpropan-1-ol.
| Compound Name | 1-[4,5-dimethoxy-2-(methylamino)phenyl]-3-pyrrolidin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 144811822 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[4,5-dimethoxy-2-(methylamino)phenyl]-3-pyrrolidin-1-ylpropan-1-ol |
| SMILES | CNc1cc(OC)c(OC)cc1C(O)CCN1CCCC1 |
| InChI | InChI=1S/C16H26N2O3/c1-17-13-11-16(21-3)15(20-2)10-12(13)14(19)6-9-18-7-4-5-8-18/h10-11,14,17,19H,4-9H2,1-3H3 |
| InChIKey | AQMYMUCFBIALHG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|