About 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde
1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde (PubChem CID 144811968) has the molecular formula C20H24FNO6
and a molecular weight of 393.41 g/mol. Its IUPAC name is 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde |
| PubChem CID | 144811968 |
| Molecular Formula | C20H24FNO6 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde |
| SMILES | Cc1ccc(-c2cc(OC(O)(O)CO)ccc2F)cc1.O=CN1CCOCC1 |
| InChI | InChI=1S/C15H15FO4.C5H9NO2/c1-10-2-4-11(5-3-10)13-8-12(6-7-14(13)16)20-15(18,19)9-17;7-5-6-1-3-8-4-2-6/h2-8,17-19H,9H2,1H3;5H,1-4H2 |
| InChIKey | VBVIHISEJAQHEH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde?
The IUPAC name of 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde (CID 144811968) is 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde.
What is the SMILES notation for 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde?
The canonical SMILES for 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde is Cc1ccc(-c2cc(OC(O)(O)CO)ccc2F)cc1.O=CN1CCOCC1.
What is the InChIKey of 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde?
The InChIKey is VBVIHISEJAQHEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FO4.C5H9NO2/c1-10-2-4-11(5-3-10)13-8-12(6-7-14(13)16)20-15(18,19)9-17;7-5-6-1-3-8-4-2-6/h2-8,17-19H,9H2,1H3;5H,1-4H2.
What are the key properties of 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde?
1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde has a molecular weight of 393.41 g/mol, XLogP of 1.29, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-fluoro-3-(4-methylphenyl)phenoxy]ethane-1,1,2-triol;morpholine-4-carbaldehyde is sourced from PubChem (CID 144811968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).