C19H18ClN5O3 — CID 144811991
(E)-3-(6-amino-3-pyridinyl)-N-[2-[2-chloro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenoxy]ethyl]prop-2-enamide (PubChem CID 144811991) has the molecular formula C19H18ClN5O3 and a molecular weight of 399.84 g/mol. Its IUPAC name is (E)-3-(6-amino-3-pyridinyl)-N-[2-[2-chloro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenoxy]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(6-amino-3-pyridinyl)-N-[2-[2-chloro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 144811991 |
| Molecular Formula | C19H18ClN5O3 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (E)-3-(6-amino-3-pyridinyl)-N-[2-[2-chloro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenoxy]ethyl]prop-2-enamide |
| SMILES | Cc1nnc(-c2ccc(OCCNC(=O)/C=C/c3ccc(N)nc3)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H18ClN5O3/c1-12-24-25-19(28-12)14-4-5-16(15(20)10-14)27-9-8-22-18(26)7-3-13-2-6-17(21)23-11-13/h2-7,10-11H,8-9H2,1H3,(H2,21,23)(H,22,26)/b7-3+ |
| InChIKey | JBKISCKLLQFTAP-XVNBXDOJSA-N |
| XLogP | 2.88 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|