C11H18N4O3 — CID 144812209
N-[1-(2,4-dioxoimidazolidin-1-yl)ethyl]-N-[2-(methylamino)prop-2-enyl]acetamide (PubChem CID 144812209) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is N-[1-(2,4-dioxoimidazolidin-1-yl)ethyl]-N-[2-(methylamino)prop-2-enyl]acetamide.
| Compound Name | N-[1-(2,4-dioxoimidazolidin-1-yl)ethyl]-N-[2-(methylamino)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 144812209 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[1-(2,4-dioxoimidazolidin-1-yl)ethyl]-N-[2-(methylamino)prop-2-enyl]acetamide |
| SMILES | C=C(CN(C(C)=O)C(C)N1CC(=O)NC1=O)NC |
| InChI | InChI=1S/C11H18N4O3/c1-7(12-4)5-14(9(3)16)8(2)15-6-10(17)13-11(15)18/h8,12H,1,5-6H2,2-4H3,(H,13,17,18) |
| InChIKey | LJPLZDYXDQTGEE-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|