About ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine
ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine (PubChem CID 144812613) has the molecular formula C20H35NS
and a molecular weight of 321.57 g/mol. Its IUPAC name is ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine.
Molecular Properties
| Compound Name | ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine |
| PubChem CID | 144812613 |
| Molecular Formula | C20H35NS |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine |
| SMILES | CC.CC.CCC1(C)C=CC2=C(C=C1)SC(C)(C(C)C)C=N2 |
| InChI | InChI=1S/C16H23NS.2C2H6/c1-6-15(4)9-7-13-14(8-10-15)18-16(5,11-17-13)12(2)3;2*1-2/h7-12H,6H2,1-5H3;2*1-2H3 |
| InChIKey | OXSVSZGYTSKCLG-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine?
The IUPAC name of ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine (CID 144812613) is ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine.
What is the SMILES notation for ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine?
The canonical SMILES for ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine is CC.CC.CCC1(C)C=CC2=C(C=C1)SC(C)(C(C)C)C=N2.
What is the InChIKey of ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine?
The InChIKey is OXSVSZGYTSKCLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NS.2C2H6/c1-6-15(4)9-7-13-14(8-10-15)18-16(5,11-17-13)12(2)3;2*1-2/h7-12H,6H2,1-5H3;2*1-2H3.
What are the key properties of ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine?
ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine has a molecular weight of 321.57 g/mol, XLogP of 7.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-ethyl-2,7-dimethyl-2-propan-2-ylcyclohepta[b][1,4]thiazine is sourced from PubChem (CID 144812613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).