C12H23NO — CID 144812676
6-ethyl-6-methyl-3,4,4a,5,7,8,9,9a-octahydro-2H-pyrano[2,3-c]azepine (PubChem CID 144812676) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 6-ethyl-6-methyl-3,4,4a,5,7,8,9,9a-octahydro-2H-pyrano[2,3-c]azepine.
| Compound Name | 6-ethyl-6-methyl-3,4,4a,5,7,8,9,9a-octahydro-2H-pyrano[2,3-c]azepine |
|---|---|
| PubChem CID | 144812676 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 6-ethyl-6-methyl-3,4,4a,5,7,8,9,9a-octahydro-2H-pyrano[2,3-c]azepine |
| SMILES | CCC1(C)CNCC2OCCCC2C1 |
| InChI | InChI=1S/C12H23NO/c1-3-12(2)7-10-5-4-6-14-11(10)8-13-9-12/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | GKDBJFLMFHEROU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |