About 1-propan-2-yl-1,2-diazaspiro[4.4]nonane
1-propan-2-yl-1,2-diazaspiro[4.4]nonane (PubChem CID 144812710) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-propan-2-yl-1,2-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 1-propan-2-yl-1,2-diazaspiro[4.4]nonane |
| PubChem CID | 144812710 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-propan-2-yl-1,2-diazaspiro[4.4]nonane |
| SMILES | CC(C)N1NCCC12CCCC2 |
| InChI | InChI=1S/C10H20N2/c1-9(2)12-10(7-8-11-12)5-3-4-6-10/h9,11H,3-8H2,1-2H3 |
| InChIKey | QOGLZABJNRIZLM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-propan-2-yl-1,2-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-1,2-diazaspiro[4.4]nonane?
The IUPAC name of 1-propan-2-yl-1,2-diazaspiro[4.4]nonane (CID 144812710) is 1-propan-2-yl-1,2-diazaspiro[4.4]nonane.
What is the SMILES notation for 1-propan-2-yl-1,2-diazaspiro[4.4]nonane?
The canonical SMILES for 1-propan-2-yl-1,2-diazaspiro[4.4]nonane is CC(C)N1NCCC12CCCC2.
What is the InChIKey of 1-propan-2-yl-1,2-diazaspiro[4.4]nonane?
The InChIKey is QOGLZABJNRIZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-9(2)12-10(7-8-11-12)5-3-4-6-10/h9,11H,3-8H2,1-2H3.
What are the key properties of 1-propan-2-yl-1,2-diazaspiro[4.4]nonane?
1-propan-2-yl-1,2-diazaspiro[4.4]nonane has a molecular weight of 168.28 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-1,2-diazaspiro[4.4]nonane is sourced from PubChem (CID 144812710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).