About 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine
2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine (PubChem CID 144812724) has the molecular formula C15H25N3
and a molecular weight of 247.39 g/mol. Its IUPAC name is 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine.
Molecular Properties
| Compound Name | 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine |
| PubChem CID | 144812724 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine |
| SMILES | [H]/N=C1\C=CC(C)(C)C=NN1/C=C\C(C)C(C)CC |
| InChI | InChI=1S/C15H25N3/c1-6-12(2)13(3)8-10-18-14(16)7-9-15(4,5)11-17-18/h7-13,16H,6H2,1-5H3/b10-8-,16-14+ |
| InChIKey | RXUQNUFTOHYRLX-LMQVGZRLSA-N |
| XLogP | 4.04 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine?
The IUPAC name of 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine (CID 144812724) is 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine.
What is the SMILES notation for 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine?
The canonical SMILES for 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine is [H]/N=C1\C=CC(C)(C)C=NN1/C=C\C(C)C(C)CC.
What is the InChIKey of 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine?
The InChIKey is RXUQNUFTOHYRLX-LMQVGZRLSA-N. The full InChI is InChI=1S/C15H25N3/c1-6-12(2)13(3)8-10-18-14(16)7-9-15(4,5)11-17-18/h7-13,16H,6H2,1-5H3/b10-8-,16-14+.
What are the key properties of 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine?
2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine has a molecular weight of 247.39 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-3,4-dimethylhex-1-enyl]-6,6-dimethyldiazepin-3-imine is sourced from PubChem (CID 144812724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).