C28H33F2N3O2 — CID 144813172
(E)-2-(3,6-difluoro-2-methylphenyl)-N-(oxan-4-yl)but-2-enamide;4-(4-ethylphenyl)-1-methylpyrazole (PubChem CID 144813172) has the molecular formula C28H33F2N3O2 and a molecular weight of 481.59 g/mol. Its IUPAC name is (E)-2-(3,6-difluoro-2-methylphenyl)-N-(oxan-4-yl)but-2-enamide;4-(4-ethylphenyl)-1-methylpyrazole.
| Compound Name | (E)-2-(3,6-difluoro-2-methylphenyl)-N-(oxan-4-yl)but-2-enamide;4-(4-ethylphenyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 144813172 |
| Molecular Formula | C28H33F2N3O2 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (E)-2-(3,6-difluoro-2-methylphenyl)-N-(oxan-4-yl)but-2-enamide;4-(4-ethylphenyl)-1-methylpyrazole |
| SMILES | C/C=C(/C(=O)NC1CCOCC1)c1c(F)ccc(F)c1C.CCc1ccc(-c2cnn(C)c2)cc1 |
| InChI | InChI=1S/C16H19F2NO2.C12H14N2/c1-3-12(15-10(2)13(17)4-5-14(15)18)16(20)19-11-6-8-21-9-7-11;1-3-10-4-6-11(7-5-10)12-8-13-14(2)9-12/h3-5,11H,6-9H2,1-2H3,(H,19,20);4-9H,3H2,1-2H3/b12-3+; |
| InChIKey | VMSDLAJLNSDMQQ-QXKVDVGOSA-N |
| XLogP | 5.62 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|