C27H34BFO6 — CID 144813225
2-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(6-hydroxy-1-benzofuran-3-yl)acetaldehyde;methoxymethane (PubChem CID 144813225) has the molecular formula C27H34BFO6 and a molecular weight of 484.37 g/mol. Its IUPAC name is 2-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(6-hydroxy-1-benzofuran-3-yl)acetaldehyde;methoxymethane.
| Compound Name | 2-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(6-hydroxy-1-benzofuran-3-yl)acetaldehyde;methoxymethane |
|---|---|
| PubChem CID | 144813225 |
| Molecular Formula | C27H34BFO6 |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-(7-fluoro-2,3-dihydro-1H-inden-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(6-hydroxy-1-benzofuran-3-yl)acetaldehyde;methoxymethane |
| SMILES | CC1(C)OB(c2ccc(F)c3c2CCC3)OC1(C)C.COC.O=CCc1coc2cc(O)ccc12 |
| InChI | InChI=1S/C15H20BFO2.C10H8O3.C2H6O/c1-14(2)15(3,4)19-16(18-14)12-8-9-13(17)11-7-5-6-10(11)12;11-4-3-7-6-13-10-5-8(12)1-2-9(7)10;1-3-2/h8-9H,5-7H2,1-4H3;1-2,4-6,12H,3H2;1-2H3 |
| InChIKey | YTCCBRFVDBWGFJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|