About 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane
6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane (PubChem CID 144813636) has the molecular formula C11H15BrN2
and a molecular weight of 255.16 g/mol. Its IUPAC name is 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane.
Molecular Properties
| Compound Name | 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane |
| PubChem CID | 144813636 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane |
| SMILES | CC.CCc1c[nH]c2cc(Br)ncc12 |
| InChI | InChI=1S/C9H9BrN2.C2H6/c1-2-6-4-11-8-3-9(10)12-5-7(6)8;1-2/h3-5,11H,2H2,1H3;1-2H3 |
| InChIKey | JCIFYQQOUREHAQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane?
The IUPAC name of 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane (CID 144813636) is 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane.
What is the SMILES notation for 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane?
The canonical SMILES for 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane is CC.CCc1c[nH]c2cc(Br)ncc12.
What is the InChIKey of 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane?
The InChIKey is JCIFYQQOUREHAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2.C2H6/c1-2-6-4-11-8-3-9(10)12-5-7(6)8;1-2/h3-5,11H,2H2,1H3;1-2H3.
What are the key properties of 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane?
6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane has a molecular weight of 255.16 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-ethyl-1H-pyrrolo[3,2-c]pyridine;ethane is sourced from PubChem (CID 144813636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).