C22H27N5O2S2 — CID 144814345
4-methylidenepiperidine-1-carbaldehyde;1-[4-methyl-5-[2-[(5-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanol (PubChem CID 144814345) has the molecular formula C22H27N5O2S2 and a molecular weight of 457.63 g/mol. Its IUPAC name is 4-methylidenepiperidine-1-carbaldehyde;1-[4-methyl-5-[2-[(5-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanol.
| Compound Name | 4-methylidenepiperidine-1-carbaldehyde;1-[4-methyl-5-[2-[(5-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 144814345 |
| Molecular Formula | C22H27N5O2S2 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 4-methylidenepiperidine-1-carbaldehyde;1-[4-methyl-5-[2-[(5-methyl-2-pyridinyl)amino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanol |
| SMILES | C=C1CCN(C=O)CC1.Cc1ccc(Nc2nc(-c3sc(C(C)O)nc3C)cs2)nc1 |
| InChI | InChI=1S/C15H16N4OS2.C7H11NO/c1-8-4-5-12(16-6-8)19-15-18-11(7-21-15)13-9(2)17-14(22-13)10(3)20;1-7-2-4-8(6-9)5-3-7/h4-7,10,20H,1-3H3,(H,16,18,19);6H,1-5H2 |
| InChIKey | SFSMZGUFUHERND-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|