C25H32N6O2S2 — CID 144814477
[(4Z,5R)-3,5-diethyl-4-methoxyimino-3-methylpiperidin-1-yl]-[6-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-3-pyridinyl]methanone (PubChem CID 144814477) has the molecular formula C25H32N6O2S2 and a molecular weight of 512.71 g/mol. Its IUPAC name is [(4Z,5R)-3,5-diethyl-4-methoxyimino-3-methylpiperidin-1-yl]-[6-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-3-pyridinyl]methanone.
| Compound Name | [(4Z,5R)-3,5-diethyl-4-methoxyimino-3-methylpiperidin-1-yl]-[6-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 144814477 |
| Molecular Formula | C25H32N6O2S2 |
| Molecular Weight | 512.71 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | [(4Z,5R)-3,5-diethyl-4-methoxyimino-3-methylpiperidin-1-yl]-[6-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]-3-pyridinyl]methanone |
| SMILES | CC[C@@H]1CN(C(=O)c2ccc(Nc3nc(-c4sc(C)nc4C)cs3)nc2)CC(C)(CC)/C1=N\OC |
| InChI | InChI=1S/C25H32N6O2S2/c1-7-17-12-31(14-25(5,8-2)22(17)30-33-6)23(32)18-9-10-20(26-11-18)29-24-28-19(13-34-24)21-15(3)27-16(4)35-21/h9-11,13,17H,7-8,12,14H2,1-6H3,(H,26,28,29)/b30-22-/t17-,25?/m1/s1 |
| InChIKey | RMYGFCNPIRPNBK-JJKWXLRHSA-N |
| XLogP | 5.92 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.71 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|