About N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide
N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide (PubChem CID 144814904) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide.
Molecular Properties
| Compound Name | N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide |
| PubChem CID | 144814904 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide |
| SMILES | CN(C=O)[C@H]1CC[C@@H](C=O)C1 |
| InChI | InChI=1S/C8H13NO2/c1-9(6-11)8-3-2-7(4-8)5-10/h5-8H,2-4H2,1H3/t7-,8+/m1/s1 |
| InChIKey | QFHFRONESSGEID-SFYZADRCSA-N |
| XLogP | 0.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide?
The IUPAC name of N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide (CID 144814904) is N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide.
What is the SMILES notation for N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide?
The canonical SMILES for N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide is CN(C=O)[C@H]1CC[C@@H](C=O)C1.
What is the InChIKey of N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide?
The InChIKey is QFHFRONESSGEID-SFYZADRCSA-N. The full InChI is InChI=1S/C8H13NO2/c1-9(6-11)8-3-2-7(4-8)5-10/h5-8H,2-4H2,1H3/t7-,8+/m1/s1.
What are the key properties of N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide?
N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide has a molecular weight of 155.20 g/mol, XLogP of 0.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,3R)-3-formylcyclopentyl]-N-methylformamide is sourced from PubChem (CID 144814904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).