C59H89N3O4 — CID 144815124
[2-[[4-[bis[4-(diethylamino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2,4,4-trimethyl-2-propan-2-ylpentanoate;2,4,4-trimethyl-2-propan-2-ylpentanoic acid (PubChem CID 144815124) has the molecular formula C59H89N3O4 and a molecular weight of 904.38 g/mol. Its IUPAC name is [2-[[4-[bis[4-(diethylamino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2,4,4-trimethyl-2-propan-2-ylpentanoate;2,4,4-trimethyl-2-propan-2-ylpentanoic acid.
| Compound Name | [2-[[4-[bis[4-(diethylamino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2,4,4-trimethyl-2-propan-2-ylpentanoate;2,4,4-trimethyl-2-propan-2-ylpentanoic acid |
|---|---|
| PubChem CID | 144815124 |
| Molecular Formula | C59H89N3O4 |
| Molecular Weight | 904.38 g/mol |
| Exact Mass | 903.69 |
| IUPAC Name | [2-[[4-[bis[4-(diethylamino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2,4,4-trimethyl-2-propan-2-ylpentanoate;2,4,4-trimethyl-2-propan-2-ylpentanoic acid |
| SMILES | CC(C)C(C)(CC(C)(C)C)C(=O)O.CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2)c2ccc(NC3CCCCC3OC(=O)C(C)(CC(C)(C)C)C(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C48H67N3O2.C11H22O2/c1-11-50(12-2)37-27-23-35(24-28-37)45(36-25-29-38(30-26-36)51(13-3)14-4)41-31-32-42(40-20-16-15-19-39(40)41)49-43-21-17-18-22-44(43)53-46(52)48(10,34(5)6)33-47(7,8)9;1-8(2)11(6,9(12)13)7-10(3,4)5/h15-16,19-20,23-32,34,43-45,49H,11-14,17-18,21-22,33H2,1-10H3;8H,7H2,1-6H3,(H,12,13) |
| InChIKey | IGFWJORTFHLWAA-UHFFFAOYSA-N |
| XLogP | 15.25 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.38 |
| LogP ≤ 5 | 15.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|