C24H43N3 — CID 144815194
ethane;1-N'-[(4Z)-4-ethenylhepta-4,6-dienyl]-1-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]ethene-1,1-diamine;methanamine (PubChem CID 144815194) has the molecular formula C24H43N3 and a molecular weight of 373.63 g/mol. Its IUPAC name is ethane;1-N'-[(4Z)-4-ethenylhepta-4,6-dienyl]-1-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]ethene-1,1-diamine;methanamine.
| Compound Name | ethane;1-N'-[(4Z)-4-ethenylhepta-4,6-dienyl]-1-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]ethene-1,1-diamine;methanamine |
|---|---|
| PubChem CID | 144815194 |
| Molecular Formula | C24H43N3 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.35 |
| IUPAC Name | ethane;1-N'-[(4Z)-4-ethenylhepta-4,6-dienyl]-1-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]ethene-1,1-diamine;methanamine |
| SMILES | C=C/C=C\C(=C/C)CCCNC(=C)NCCC/C(C=C)=C/C=C.CC.CN |
| InChI | InChI=1S/C21H32N2.C2H6.CH5N/c1-6-10-14-21(9-4)16-12-18-23-19(5)22-17-11-15-20(8-3)13-7-2;2*1-2/h6-10,13-14,22-23H,1-3,5,11-12,15-18H2,4H3;1-2H3;2H2,1H3/b14-10-,20-13+,21-9+;; |
| InChIKey | DKNBIABKVAKXHJ-OMCYGCFVSA-N |
| XLogP | 5.79 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|