C21H32N2 — CID 144815195
1-N'-[(4Z)-4-ethenylhepta-4,6-dienyl]-1-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]ethene-1,1-diamine (PubChem CID 144815195) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 1-N'-[(4Z)-4-ethenylhepta-4,6-dienyl]-1-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]ethene-1,1-diamine.
| Compound Name | 1-N'-[(4Z)-4-ethenylhepta-4,6-dienyl]-1-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 144815195 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 1-N'-[(4Z)-4-ethenylhepta-4,6-dienyl]-1-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]ethene-1,1-diamine |
| SMILES | C=C/C=C\C(=C/C)CCCNC(=C)NCCC/C(C=C)=C/C=C |
| InChI | InChI=1S/C21H32N2/c1-6-10-14-21(9-4)16-12-18-23-19(5)22-17-11-15-20(8-3)13-7-2/h6-10,13-14,22-23H,1-3,5,11-12,15-18H2,4H3/b14-10-,20-13+,21-9+ |
| InChIKey | DOXVGJRJSQMPMB-CGFIWROCSA-N |
| XLogP | 5.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|