C62H48N2 — CID 144815906
3-(3-cyclohexa-1,5-dien-1-ylphenyl)-7-(3,5-diphenylphenyl)-10-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]pyrrolo[3,2-a]carbazole (PubChem CID 144815906) has the molecular formula C62H48N2 and a molecular weight of 821.08 g/mol. Its IUPAC name is 3-(3-cyclohexa-1,5-dien-1-ylphenyl)-7-(3,5-diphenylphenyl)-10-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]pyrrolo[3,2-a]carbazole.
| Compound Name | 3-(3-cyclohexa-1,5-dien-1-ylphenyl)-7-(3,5-diphenylphenyl)-10-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]pyrrolo[3,2-a]carbazole |
|---|---|
| PubChem CID | 144815906 |
| Molecular Formula | C62H48N2 |
| Molecular Weight | 821.08 g/mol |
| Exact Mass | 820.38 |
| IUPAC Name | 3-(3-cyclohexa-1,5-dien-1-ylphenyl)-7-(3,5-diphenylphenyl)-10-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]pyrrolo[3,2-a]carbazole |
| SMILES | C/C=C\C(=C/C)c1cc(-c2ccccc2)cc(-n2c3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc3c3ccc4c(ccn4-c4cccc(C5=CCCC=C5)c4)c32)c1 |
| InChI | InChI=1S/C62H48N2/c1-3-18-43(4-2)53-38-54(47-25-15-8-16-26-47)41-56(40-53)64-61-31-29-49(52-36-50(45-21-11-6-12-22-45)35-51(37-52)46-23-13-7-14-24-46)42-59(61)57-30-32-60-58(62(57)64)33-34-63(60)55-28-17-27-48(39-55)44-19-9-5-10-20-44/h3-4,6-9,11-42H,5,10H2,1-2H3/b18-3-,43-4+ |
| InChIKey | GZQMPANBFPREQF-JHCJLRARSA-N |
| XLogP | 17.11 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.08 |
| LogP ≤ 5 | 17.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|