C16H26N2O2 — CID 144816942
ethane;1-formyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidine-2-carboxamide (PubChem CID 144816942) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is ethane;1-formyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidine-2-carboxamide.
| Compound Name | ethane;1-formyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 144816942 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | ethane;1-formyl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidine-2-carboxamide |
| SMILES | C=C/C=C(\C=C/C)NC(=O)C1CCCCN1C=O.CC |
| InChI | InChI=1S/C14H20N2O2.C2H6/c1-3-7-12(8-4-2)15-14(18)13-9-5-6-10-16(13)11-17;1-2/h3-4,7-8,11,13H,1,5-6,9-10H2,2H3,(H,15,18);1-2H3/b8-4-,12-7+; |
| InChIKey | OSBZEWCTJFJIAX-NFZKUONPSA-N |
| XLogP | 2.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|