C26H35FN8O2 — CID 144817129
N-amino-N',3,3,4-tetramethyl-2-oxopiperazine-1-carboximidamide;8-tert-butyl-6-(4-fluorophenyl)imidazo[1,2-b]pyridazine-2-carbaldehyde (PubChem CID 144817129) has the molecular formula C26H35FN8O2 and a molecular weight of 510.62 g/mol. Its IUPAC name is N-amino-N',3,3,4-tetramethyl-2-oxopiperazine-1-carboximidamide;8-tert-butyl-6-(4-fluorophenyl)imidazo[1,2-b]pyridazine-2-carbaldehyde.
| Compound Name | N-amino-N',3,3,4-tetramethyl-2-oxopiperazine-1-carboximidamide;8-tert-butyl-6-(4-fluorophenyl)imidazo[1,2-b]pyridazine-2-carbaldehyde |
|---|---|
| PubChem CID | 144817129 |
| Molecular Formula | C26H35FN8O2 |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | N-amino-N',3,3,4-tetramethyl-2-oxopiperazine-1-carboximidamide;8-tert-butyl-6-(4-fluorophenyl)imidazo[1,2-b]pyridazine-2-carbaldehyde |
| SMILES | C/N=C(\NN)N1CCN(C)C(C)(C)C1=O.CC(C)(C)c1cc(-c2ccc(F)cc2)nn2cc(C=O)nc12 |
| InChI | InChI=1S/C17H16FN3O.C9H19N5O/c1-17(2,3)14-8-15(11-4-6-12(18)7-5-11)20-21-9-13(10-22)19-16(14)21;1-9(2)7(15)14(6-5-13(9)4)8(11-3)12-10/h4-10H,1-3H3;5-6,10H2,1-4H3,(H,11,12) |
| InChIKey | FYCUNNSQQXQHLI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|