C27H31FN6O2 — CID 144817489
2-[(Z)-1-(4-fluorophenyl)-1-iminopent-2-en-3-yl]-1H-imidazole-5-carbaldehyde;1-(4-methylpiperazin-1-yl)-2-pyridin-4-ylethanone (PubChem CID 144817489) has the molecular formula C27H31FN6O2 and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-[(Z)-1-(4-fluorophenyl)-1-iminopent-2-en-3-yl]-1H-imidazole-5-carbaldehyde;1-(4-methylpiperazin-1-yl)-2-pyridin-4-ylethanone.
| Compound Name | 2-[(Z)-1-(4-fluorophenyl)-1-iminopent-2-en-3-yl]-1H-imidazole-5-carbaldehyde;1-(4-methylpiperazin-1-yl)-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 144817489 |
| Molecular Formula | C27H31FN6O2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2-[(Z)-1-(4-fluorophenyl)-1-iminopent-2-en-3-yl]-1H-imidazole-5-carbaldehyde;1-(4-methylpiperazin-1-yl)-2-pyridin-4-ylethanone |
| SMILES | CN1CCN(C(=O)Cc2ccncc2)CC1.[H]/N=C(/C=C(/CC)c1ncc(C=O)[nH]1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FN3O.C12H17N3O/c1-2-10(15-18-8-13(9-20)19-15)7-14(17)11-3-5-12(16)6-4-11;1-14-6-8-15(9-7-14)12(16)10-11-2-4-13-5-3-11/h3-9,17H,2H2,1H3,(H,18,19);2-5H,6-10H2,1H3/b10-7-,17-14-; |
| InChIKey | FTJQDWMDTPIAMA-CLOQBHOLSA-N |
| XLogP | 3.62 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|