About 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine
2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine (PubChem CID 144817888) has the molecular formula C22H26N4
and a molecular weight of 346.48 g/mol. Its IUPAC name is 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine |
| PubChem CID | 144817888 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine |
| SMILES | Cc1cc([C@H]2CCC2c2ccccc2)nc(C)n1.Cc1ccnc(C)n1 |
| InChI | InChI=1S/C16H18N2.C6H8N2/c1-11-10-16(18-12(2)17-11)15-9-8-14(15)13-6-4-3-5-7-13;1-5-3-4-7-6(2)8-5/h3-7,10,14-15H,8-9H2,1-2H3;3-4H,1-2H3/t14?,15-;/m0./s1 |
| InChIKey | MERDWPCTIGOBKW-SCYKNNLXSA-N |
| XLogP | 4.85 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine?
The IUPAC name of 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine (CID 144817888) is 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine.
What is the SMILES notation for 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine?
The canonical SMILES for 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine is Cc1cc([C@H]2CCC2c2ccccc2)nc(C)n1.Cc1ccnc(C)n1.
What is the InChIKey of 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine?
The InChIKey is MERDWPCTIGOBKW-SCYKNNLXSA-N. The full InChI is InChI=1S/C16H18N2.C6H8N2/c1-11-10-16(18-12(2)17-11)15-9-8-14(15)13-6-4-3-5-7-13;1-5-3-4-7-6(2)8-5/h3-7,10,14-15H,8-9H2,1-2H3;3-4H,1-2H3/t14?,15-;/m0./s1.
What are the key properties of 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine?
2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine has a molecular weight of 346.48 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-6-[(1S)-2-phenylcyclobutyl]pyrimidine;2,4-dimethylpyrimidine is sourced from PubChem (CID 144817888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).