C26H20F12N4O4 — CID 144817933
4-[3-[2,6-bis(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-2-phenylcyclobutyl]-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine (PubChem CID 144817933) has the molecular formula C26H20F12N4O4 and a molecular weight of 680.45 g/mol. Its IUPAC name is 4-[3-[2,6-bis(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-2-phenylcyclobutyl]-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine.
| Compound Name | 4-[3-[2,6-bis(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-2-phenylcyclobutyl]-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
|---|---|
| PubChem CID | 144817933 |
| Molecular Formula | C26H20F12N4O4 |
| Molecular Weight | 680.45 g/mol |
| Exact Mass | 680.13 |
| IUPAC Name | 4-[3-[2,6-bis(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-2-phenylcyclobutyl]-2,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
| SMILES | FC(F)(F)COc1cc(C2CC(c3cc(OCC(F)(F)F)nc(OCC(F)(F)F)n3)C2c2ccccc2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C26H20F12N4O4/c27-23(28,29)9-43-18-7-16(39-21(41-18)45-11-25(33,34)35)14-6-15(20(14)13-4-2-1-3-5-13)17-8-19(44-10-24(30,31)32)42-22(40-17)46-12-26(36,37)38/h1-5,7-8,14-15,20H,6,9-12H2 |
| InChIKey | YZUBDRDWEVOXAP-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.45 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |