About benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine
benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine (PubChem CID 144818057) has the molecular formula C24H24N4
and a molecular weight of 368.48 g/mol. Its IUPAC name is benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine.
Molecular Properties
| Compound Name | benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine |
| PubChem CID | 144818057 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine |
| SMILES | c1ccccc1.c1ccccc1.c1cnc([C@H]2CC[C@H]2c2cnccn2)cn1 |
| InChI | InChI=1S/C12H12N4.2C6H6/c1-2-10(12-8-14-4-6-16-12)9(1)11-7-13-3-5-15-11;2*1-2-4-6-5-3-1/h3-10H,1-2H2;2*1-6H/t9-,10+;; |
| InChIKey | OICXDMCVNFDQOS-BUQWBUBUSA-N |
| XLogP | 5.30 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine?
The IUPAC name of benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine (CID 144818057) is benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine.
What is the SMILES notation for benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine?
The canonical SMILES for benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine is c1ccccc1.c1ccccc1.c1cnc([C@H]2CC[C@H]2c2cnccn2)cn1.
What is the InChIKey of benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine?
The InChIKey is OICXDMCVNFDQOS-BUQWBUBUSA-N. The full InChI is InChI=1S/C12H12N4.2C6H6/c1-2-10(12-8-14-4-6-16-12)9(1)11-7-13-3-5-15-11;2*1-2-4-6-5-3-1/h3-10H,1-2H2;2*1-6H/t9-,10+;;.
What are the key properties of benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine?
benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine has a molecular weight of 368.48 g/mol, XLogP of 5.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-[(1S,2R)-2-pyrazin-2-ylcyclobutyl]pyrazine is sourced from PubChem (CID 144818057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).