C23H36O4 — CID 144818147
propan-2-yl (5Z,9E)-9-formyl-12-hydroxy-8-[(Z)-prop-1-enyl]hexadeca-5,9,15-trienoate (PubChem CID 144818147) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is propan-2-yl (5Z,9E)-9-formyl-12-hydroxy-8-[(Z)-prop-1-enyl]hexadeca-5,9,15-trienoate.
| Compound Name | propan-2-yl (5Z,9E)-9-formyl-12-hydroxy-8-[(Z)-prop-1-enyl]hexadeca-5,9,15-trienoate |
|---|---|
| PubChem CID | 144818147 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | propan-2-yl (5Z,9E)-9-formyl-12-hydroxy-8-[(Z)-prop-1-enyl]hexadeca-5,9,15-trienoate |
| SMILES | C=CCCC(O)C/C=C(/C=O)C(/C=C\C)C/C=C\CCCC(=O)OC(C)C |
| InChI | InChI=1S/C23H36O4/c1-5-7-14-22(25)17-16-21(18-24)20(12-6-2)13-10-8-9-11-15-23(26)27-19(3)4/h5-6,8,10,12,16,18-20,22,25H,1,7,9,11,13-15,17H2,2-4H3/b10-8-,12-6-,21-16- |
| InChIKey | IDLZOGYHAAVNHV-IEHAPXRGSA-N |
| XLogP | 5.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|