C16H21FO — CID 144818193
(4S,5E)-5-[(Z,3S)-3-fluorooct-5-enylidene]-4-prop-2-enylcyclopent-2-en-1-one (PubChem CID 144818193) has the molecular formula C16H21FO and a molecular weight of 248.34 g/mol. Its IUPAC name is (4S,5E)-5-[(Z,3S)-3-fluorooct-5-enylidene]-4-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | (4S,5E)-5-[(Z,3S)-3-fluorooct-5-enylidene]-4-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 144818193 |
| Molecular Formula | C16H21FO |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (4S,5E)-5-[(Z,3S)-3-fluorooct-5-enylidene]-4-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CC[C@H]1C=CC(=O)/C1=C/C[C@@H](F)C/C=C\CC |
| InChI | InChI=1S/C16H21FO/c1-3-5-6-8-14(17)10-11-15-13(7-4-2)9-12-16(15)18/h4-6,9,11-14H,2-3,7-8,10H2,1H3/b6-5-,15-11+/t13-,14-/m0/s1 |
| InChIKey | CMYSRCMEMWXUTP-DJXVUDTNSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|