C23H28F3NO2 — CID 144818591
(3aS,6aR)-2-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;toluene (PubChem CID 144818591) has the molecular formula C23H28F3NO2 and a molecular weight of 407.48 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;toluene.
| Compound Name | (3aS,6aR)-2-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;toluene |
|---|---|
| PubChem CID | 144818591 |
| Molecular Formula | C23H28F3NO2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (3aS,6aR)-2-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol;toluene |
| SMILES | Cc1ccccc1.OC1C[C@@H]2CN(CC(O)c3cccc(C(F)(F)F)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C16H20F3NO2.C7H8/c17-16(18,19)13-3-1-2-10(4-13)15(22)9-20-7-11-5-14(21)6-12(11)8-20;1-7-5-3-2-4-6-7/h1-4,11-12,14-15,21-22H,5-9H2;2-6H,1H3/t11-,12+,14?,15?; |
| InChIKey | XYGUPBGMQIEOBT-IZTXHGRQSA-N |
| XLogP | 4.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |