C25H33N3O3S — CID 144818757
N-[6-[1-[(3aS)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]-3-pyridinyl]methanesulfonamide;acetylene (PubChem CID 144818757) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is N-[6-[1-[(3aS)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]-3-pyridinyl]methanesulfonamide;acetylene.
| Compound Name | N-[6-[1-[(3aS)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]-3-pyridinyl]methanesulfonamide;acetylene |
|---|---|
| PubChem CID | 144818757 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[6-[1-[(3aS)-5-benzyl-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]propan-2-yl]-3-pyridinyl]methanesulfonamide;acetylene |
| SMILES | C#C.CC(CN1CC2CC(O)(Cc3ccccc3)C[C@@H]2C1)c1ccc(NS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C23H31N3O3S.C2H2/c1-17(22-9-8-21(13-24-22)25-30(2,28)29)14-26-15-19-11-23(27,12-20(19)16-26)10-18-6-4-3-5-7-18;1-2/h3-9,13,17,19-20,25,27H,10-12,14-16H2,1-2H3;1-2H/t17?,19-,20?,23?;/m1./s1 |
| InChIKey | RXVXSXRTMGOXGE-DPTQXANHSA-N |
| XLogP | 3.12 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|