C21H30N2 — CID 144819208
1-but-1-en-3-yn-2-yl-4-[(2Z,4E,6E,8Z)-4-ethylidene-6-methyldeca-2,6,8-trien-5-yl]piperazine (PubChem CID 144819208) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-but-1-en-3-yn-2-yl-4-[(2Z,4E,6E,8Z)-4-ethylidene-6-methyldeca-2,6,8-trien-5-yl]piperazine.
| Compound Name | 1-but-1-en-3-yn-2-yl-4-[(2Z,4E,6E,8Z)-4-ethylidene-6-methyldeca-2,6,8-trien-5-yl]piperazine |
|---|---|
| PubChem CID | 144819208 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-but-1-en-3-yn-2-yl-4-[(2Z,4E,6E,8Z)-4-ethylidene-6-methyldeca-2,6,8-trien-5-yl]piperazine |
| SMILES | C#CC(=C)N1CCN(C(/C(C)=C/C=C\C)C(/C=C\C)=C/C)CC1 |
| InChI | InChI=1S/C21H30N2/c1-7-11-13-18(5)21(20(10-4)12-8-2)23-16-14-22(15-17-23)19(6)9-3/h3,7-8,10-13,21H,6,14-17H2,1-2,4-5H3/b11-7-,12-8-,18-13+,20-10+ |
| InChIKey | KYNDWZOGZWNBGD-INDYGEEGSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|