C20H22BF3N2O2 — CID 144819416
N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 144819416) has the molecular formula C20H22BF3N2O2 and a molecular weight of 390.21 g/mol. Its IUPAC name is N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 144819416 |
| Molecular Formula | C20H22BF3N2O2 |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethenyl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | C=C(Nc1cc(C(F)(F)F)ccn1)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H22BF3N2O2/c1-13(26-17-12-15(10-11-25-17)20(22,23)24)14-6-8-16(9-7-14)21-27-18(2,3)19(4,5)28-21/h6-12H,1H2,2-5H3,(H,25,26) |
| InChIKey | AVCWONWQLFWPGH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|