C14H26N2 — CID 144819756
ethane;(Z)-N-[4-methyl-6-[(Z)-prop-1-enyl]-2,3,4,5-tetrahydro-1H-azepin-7-yl]ethanimine (PubChem CID 144819756) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;(Z)-N-[4-methyl-6-[(Z)-prop-1-enyl]-2,3,4,5-tetrahydro-1H-azepin-7-yl]ethanimine.
| Compound Name | ethane;(Z)-N-[4-methyl-6-[(Z)-prop-1-enyl]-2,3,4,5-tetrahydro-1H-azepin-7-yl]ethanimine |
|---|---|
| PubChem CID | 144819756 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;(Z)-N-[4-methyl-6-[(Z)-prop-1-enyl]-2,3,4,5-tetrahydro-1H-azepin-7-yl]ethanimine |
| SMILES | C/C=C\C1=C(/N=C\C)NCCC(C)C1.CC |
| InChI | InChI=1S/C12H20N2.C2H6/c1-4-6-11-9-10(3)7-8-14-12(11)13-5-2;1-2/h4-6,10,14H,7-9H2,1-3H3;1-2H3/b6-4-,13-5-; |
| InChIKey | BNGSEGDNHPDBIQ-DUMMCLAPSA-N |
| XLogP | 3.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|