C11H16N2O — CID 144820238
(Z)-1-N-[(4-methoxyphenyl)methyl]prop-1-ene-1,2-diamine (PubChem CID 144820238) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (Z)-1-N-[(4-methoxyphenyl)methyl]prop-1-ene-1,2-diamine.
| Compound Name | (Z)-1-N-[(4-methoxyphenyl)methyl]prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 144820238 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (Z)-1-N-[(4-methoxyphenyl)methyl]prop-1-ene-1,2-diamine |
| SMILES | COc1ccc(CN/C=C(/C)N)cc1 |
| InChI | InChI=1S/C11H16N2O/c1-9(12)7-13-8-10-3-5-11(14-2)6-4-10/h3-7,13H,8,12H2,1-2H3/b9-7- |
| InChIKey | ZAIFIOLIQUMGNS-CLFYSBASSA-N |
| XLogP | 1.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |