About ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane
ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane (PubChem CID 144820379) has the molecular formula C13H18F5NS
and a molecular weight of 315.35 g/mol. Its IUPAC name is ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane |
| PubChem CID | 144820379 |
| Molecular Formula | C13H18F5NS |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane |
| SMILES | CC.CCc1cn(C)c2ccc(S(F)(F)(F)(F)F)cc12 |
| InChI | InChI=1S/C11H12F5NS.C2H6/c1-3-8-7-17(2)11-5-4-9(6-10(8)11)18(12,13,14,15)16;1-2/h4-7H,3H2,1-2H3;1-2H3 |
| InChIKey | MGHBMTSMVJKPFG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane?
The IUPAC name of ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane (CID 144820379) is ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane.
What is the SMILES notation for ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane?
The canonical SMILES for ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane is CC.CCc1cn(C)c2ccc(S(F)(F)(F)(F)F)cc12.
What is the InChIKey of ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane?
The InChIKey is MGHBMTSMVJKPFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F5NS.C2H6/c1-3-8-7-17(2)11-5-4-9(6-10(8)11)18(12,13,14,15)16;1-2/h4-7H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane?
ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane has a molecular weight of 315.35 g/mol, XLogP of 6.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3-ethyl-1-methylindol-5-yl)-pentafluoro-λ6-sulfane is sourced from PubChem (CID 144820379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).