C21H22F2N6O4 — CID 144820477
(Z)-2-(N-amino-3-methoxyanilino)-1-(2,4-difluorophenyl)ethenamine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 144820477) has the molecular formula C21H22F2N6O4 and a molecular weight of 460.44 g/mol. Its IUPAC name is (Z)-2-(N-amino-3-methoxyanilino)-1-(2,4-difluorophenyl)ethenamine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | (Z)-2-(N-amino-3-methoxyanilino)-1-(2,4-difluorophenyl)ethenamine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 144820477 |
| Molecular Formula | C21H22F2N6O4 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | (Z)-2-(N-amino-3-methoxyanilino)-1-(2,4-difluorophenyl)ethenamine;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | CC1Cn2cc([N+](=O)[O-])nc2O1.COc1cccc(N(N)/C=C(\N)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H15F2N3O.C6H7N3O3/c1-21-12-4-2-3-11(8-12)20(19)9-15(18)13-6-5-10(16)7-14(13)17;1-4-2-8-3-5(9(10)11)7-6(8)12-4/h2-9H,18-19H2,1H3;3-4H,2H2,1H3/b15-9-; |
| InChIKey | QKHRPUOQZBCEKB-SOCRLDLMSA-N |
| XLogP | 3.18 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|