C17H25N3O4 — CID 144820556
ethane;(3E,5Z)-4-methoxyocta-1,3,5,7-tetraene;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 144820556) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-methoxyocta-1,3,5,7-tetraene;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | ethane;(3E,5Z)-4-methoxyocta-1,3,5,7-tetraene;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 144820556 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | ethane;(3E,5Z)-4-methoxyocta-1,3,5,7-tetraene;2-methyl-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | C=C/C=C\C(=C/C=C)OC.CC.CC1Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C9H12O.C6H7N3O3.C2H6/c1-4-6-8-9(10-3)7-5-2;1-4-2-8-3-5(9(10)11)7-6(8)12-4;1-2/h4-8H,1-2H2,3H3;3-4H,2H2,1H3;1-2H3/b8-6-,9-7+;; |
| InChIKey | YWSJDXILWLVXMP-UYYQRFHASA-N |
| XLogP | 4.04 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|