C16H27N — CID 144820651
(3Z,5Z)-N-but-3-en-2-yl-3-methylocta-3,5,7-trien-4-amine;prop-1-ene (PubChem CID 144820651) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (3Z,5Z)-N-but-3-en-2-yl-3-methylocta-3,5,7-trien-4-amine;prop-1-ene.
| Compound Name | (3Z,5Z)-N-but-3-en-2-yl-3-methylocta-3,5,7-trien-4-amine;prop-1-ene |
|---|---|
| PubChem CID | 144820651 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (3Z,5Z)-N-but-3-en-2-yl-3-methylocta-3,5,7-trien-4-amine;prop-1-ene |
| SMILES | C=C/C=C\C(NC(C)C=C)=C(/C)CC.C=CC |
| InChI | InChI=1S/C13H21N.C3H6/c1-6-9-10-13(11(4)7-2)14-12(5)8-3;1-3-2/h6,8-10,12,14H,1,3,7H2,2,4-5H3;3H,1H2,2H3/b10-9-,13-11-; |
| InChIKey | IKQKZBYXEULMNM-MNPNNYDMSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|