About ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole
ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole (PubChem CID 144820845) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole.
Molecular Properties
| Compound Name | ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole |
| PubChem CID | 144820845 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole |
| SMILES | C/C=C\c1c(/C=C\C)n(C)c2ccccc12.CC |
| InChI | InChI=1S/C15H17N.C2H6/c1-4-8-12-13-10-6-7-11-15(13)16(3)14(12)9-5-2;1-2/h4-11H,1-3H3;1-2H3/b8-4-,9-5-; |
| InChIKey | QWZZEUNNZZNJHQ-JCXGGTBASA-N |
| XLogP | 5.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole?
The IUPAC name of ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole (CID 144820845) is ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole.
What is the SMILES notation for ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole?
The canonical SMILES for ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole is C/C=C\c1c(/C=C\C)n(C)c2ccccc12.CC.
What is the InChIKey of ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole?
The InChIKey is QWZZEUNNZZNJHQ-JCXGGTBASA-N. The full InChI is InChI=1S/C15H17N.C2H6/c1-4-8-12-13-10-6-7-11-15(13)16(3)14(12)9-5-2;1-2/h4-11H,1-3H3;1-2H3/b8-4-,9-5-;.
What are the key properties of ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole?
ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole has a molecular weight of 241.38 g/mol, XLogP of 5.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-2,3-bis[(Z)-prop-1-enyl]indole is sourced from PubChem (CID 144820845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).