About ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione
ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione (PubChem CID 144821069) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione.
Molecular Properties
| Compound Name | ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione |
| PubChem CID | 144821069 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione |
| SMILES | C=C.CN1C(=O)c2ccsc2C1=O |
| InChI | InChI=1S/C7H5NO2S.C2H4/c1-8-6(9)4-2-3-11-5(4)7(8)10;1-2/h2-3H,1H3;1-2H2 |
| InChIKey | WOIPKGNLNPWQKE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione?
The IUPAC name of ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione (CID 144821069) is ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione.
What is the SMILES notation for ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione?
The canonical SMILES for ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione is C=C.CN1C(=O)c2ccsc2C1=O.
What is the InChIKey of ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione?
The InChIKey is WOIPKGNLNPWQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2S.C2H4/c1-8-6(9)4-2-3-11-5(4)7(8)10;1-2/h2-3H,1H3;1-2H2.
What are the key properties of ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione?
ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione has a molecular weight of 195.24 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;5-methylthieno[2,3-c]pyrrole-4,6-dione is sourced from PubChem (CID 144821069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).