C18H12F4O2 — CID 144821120
2-[4-[1,1,2,2-tetrafluoro-2-[4-(oxiran-2-yl)phenyl]ethyl]phenyl]oxirene (PubChem CID 144821120) has the molecular formula C18H12F4O2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-[4-[1,1,2,2-tetrafluoro-2-[4-(oxiran-2-yl)phenyl]ethyl]phenyl]oxirene.
| Compound Name | 2-[4-[1,1,2,2-tetrafluoro-2-[4-(oxiran-2-yl)phenyl]ethyl]phenyl]oxirene |
|---|---|
| PubChem CID | 144821120 |
| Molecular Formula | C18H12F4O2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[4-[1,1,2,2-tetrafluoro-2-[4-(oxiran-2-yl)phenyl]ethyl]phenyl]oxirene |
| SMILES | FC(F)(c1ccc(C2=CO2)cc1)C(F)(F)c1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C18H12F4O2/c19-17(20,13-5-1-11(2-6-13)15-9-23-15)18(21,22)14-7-3-12(4-8-14)16-10-24-16/h1-9,16H,10H2 |
| InChIKey | UEJIGEPGFPUYSV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|