About (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine
(3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine (PubChem CID 144821177) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine.
Molecular Properties
| Compound Name | (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine |
| PubChem CID | 144821177 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine |
| SMILES | C=C(/C=C\C(=C)C(C)(C)N)NC(C)C |
| InChI | InChI=1S/C12H22N2/c1-9(2)14-11(4)8-7-10(3)12(5,6)13/h7-9,14H,3-4,13H2,1-2,5-6H3/b8-7- |
| InChIKey | SQYMYJZYJNZRGU-FPLPWBNLSA-N |
| XLogP | 2.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine?
The IUPAC name of (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine (CID 144821177) is (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine.
What is the SMILES notation for (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine?
The canonical SMILES for (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine is C=C(/C=C\C(=C)C(C)(C)N)NC(C)C.
What is the InChIKey of (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine?
The InChIKey is SQYMYJZYJNZRGU-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H22N2/c1-9(2)14-11(4)8-7-10(3)12(5,6)13/h7-9,14H,3-4,13H2,1-2,5-6H3/b8-7-.
What are the key properties of (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine?
(3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine has a molecular weight of 194.32 g/mol, XLogP of 2.35, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-6-methyl-5-methylidene-2-N-propan-2-ylhepta-1,3-diene-2,6-diamine is sourced from PubChem (CID 144821177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).