About N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol
N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol (PubChem CID 144821354) has the molecular formula C23H25BrN4S
and a molecular weight of 469.45 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol.
Molecular Properties
| Compound Name | N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol |
| PubChem CID | 144821354 |
| Molecular Formula | C23H25BrN4S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol |
| SMILES | CCc1cc(Br)ccc1Nc1ccc2c(CNC)c[nH]c2c1.Sc1cccnc1 |
| InChI | InChI=1S/C18H20BrN3.C5H5NS/c1-3-12-8-14(19)4-7-17(12)22-15-5-6-16-13(10-20-2)11-21-18(16)9-15;7-5-2-1-3-6-4-5/h4-9,11,20-22H,3,10H2,1-2H3;1-4,7H |
| InChIKey | KSEZOYFEYYSXPW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol?
The IUPAC name of N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol (CID 144821354) is N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol.
What is the SMILES notation for N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol?
The canonical SMILES for N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol is CCc1cc(Br)ccc1Nc1ccc2c(CNC)c[nH]c2c1.Sc1cccnc1.
What is the InChIKey of N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol?
The InChIKey is KSEZOYFEYYSXPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrN3.C5H5NS/c1-3-12-8-14(19)4-7-17(12)22-15-5-6-16-13(10-20-2)11-21-18(16)9-15;7-5-2-1-3-6-4-5/h4-9,11,20-22H,3,10H2,1-2H3;1-4,7H.
What are the key properties of N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol?
N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol has a molecular weight of 469.45 g/mol, XLogP of 6.33, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2-ethylphenyl)-3-(methylaminomethyl)-1H-indol-6-amine;pyridine-3-thiol is sourced from PubChem (CID 144821354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).