C26H24N6 — CID 144821702
4-methyl-3-[2-[6-[4-[[2-(methylamino)ethylamino]methyl]phenyl]imidazo[1,2-b]pyridazin-3-yl]ethynyl]benzonitrile (PubChem CID 144821702) has the molecular formula C26H24N6 and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-methyl-3-[2-[6-[4-[[2-(methylamino)ethylamino]methyl]phenyl]imidazo[1,2-b]pyridazin-3-yl]ethynyl]benzonitrile.
| Compound Name | 4-methyl-3-[2-[6-[4-[[2-(methylamino)ethylamino]methyl]phenyl]imidazo[1,2-b]pyridazin-3-yl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 144821702 |
| Molecular Formula | C26H24N6 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-methyl-3-[2-[6-[4-[[2-(methylamino)ethylamino]methyl]phenyl]imidazo[1,2-b]pyridazin-3-yl]ethynyl]benzonitrile |
| SMILES | CNCCNCc1ccc(-c2ccc3ncc(C#Cc4cc(C#N)ccc4C)n3n2)cc1 |
| InChI | InChI=1S/C26H24N6/c1-19-3-4-21(16-27)15-23(19)9-10-24-18-30-26-12-11-25(31-32(24)26)22-7-5-20(6-8-22)17-29-14-13-28-2/h3-8,11-12,15,18,28-29H,13-14,17H2,1-2H3 |
| InChIKey | SNQTZDKXGLZQMW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|