C25H27ClF3N5O2 — CID 144821781
4-[(5R,6R)-5-amino-6-(6-chloro-3-pyridinyl)-6-hydroxy-4-methylidenehexyl]-N-methyl-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]benzamide (PubChem CID 144821781) has the molecular formula C25H27ClF3N5O2 and a molecular weight of 521.97 g/mol. Its IUPAC name is 4-[(5R,6R)-5-amino-6-(6-chloro-3-pyridinyl)-6-hydroxy-4-methylidenehexyl]-N-methyl-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]benzamide.
| Compound Name | 4-[(5R,6R)-5-amino-6-(6-chloro-3-pyridinyl)-6-hydroxy-4-methylidenehexyl]-N-methyl-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 144821781 |
| Molecular Formula | C25H27ClF3N5O2 |
| Molecular Weight | 521.97 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 4-[(5R,6R)-5-amino-6-(6-chloro-3-pyridinyl)-6-hydroxy-4-methylidenehexyl]-N-methyl-N-[[3-(trifluoromethyl)-1H-pyrazol-5-yl]methyl]benzamide |
| SMILES | C=C(CCCc1ccc(C(=O)N(C)Cc2cc(C(F)(F)F)n[nH]2)cc1)[C@@H](N)[C@H](O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C25H27ClF3N5O2/c1-15(22(30)23(35)18-10-11-21(26)31-13-18)4-3-5-16-6-8-17(9-7-16)24(36)34(2)14-19-12-20(33-32-19)25(27,28)29/h6-13,22-23,35H,1,3-5,14,30H2,2H3,(H,32,33)/t22-,23-/m1/s1 |
| InChIKey | QXMAZLAESHLTDK-DHIUTWEWSA-N |
| XLogP | 4.69 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.97 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|