C23H27ClN4O3 — CID 144821918
4-[2-[[2-(6-chloro-1,2-dihydropyridin-3-yl)-2-hydroxyethyl]amino]ethyl]-N-methyl-N-[(6-oxo-1H-pyridin-3-yl)methyl]benzamide (PubChem CID 144821918) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is 4-[2-[[2-(6-chloro-1,2-dihydropyridin-3-yl)-2-hydroxyethyl]amino]ethyl]-N-methyl-N-[(6-oxo-1H-pyridin-3-yl)methyl]benzamide.
| Compound Name | 4-[2-[[2-(6-chloro-1,2-dihydropyridin-3-yl)-2-hydroxyethyl]amino]ethyl]-N-methyl-N-[(6-oxo-1H-pyridin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 144821918 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 4-[2-[[2-(6-chloro-1,2-dihydropyridin-3-yl)-2-hydroxyethyl]amino]ethyl]-N-methyl-N-[(6-oxo-1H-pyridin-3-yl)methyl]benzamide |
| SMILES | CN(Cc1ccc(=O)[nH]c1)C(=O)c1ccc(CCNCC(O)C2=CC=C(Cl)NC2)cc1 |
| InChI | InChI=1S/C23H27ClN4O3/c1-28(15-17-4-9-22(30)27-12-17)23(31)18-5-2-16(3-6-18)10-11-25-14-20(29)19-7-8-21(24)26-13-19/h2-9,12,20,25-26,29H,10-11,13-15H2,1H3,(H,27,30) |
| InChIKey | DZPMACOKWSSRHW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|