C7H16O5 — CID 144823198
6-(hydroxymethyl)oxane-3,4-diol;methanol (PubChem CID 144823198) has the molecular formula C7H16O5 and a molecular weight of 180.20 g/mol. Its IUPAC name is 6-(hydroxymethyl)oxane-3,4-diol;methanol.
| Compound Name | 6-(hydroxymethyl)oxane-3,4-diol;methanol |
|---|---|
| PubChem CID | 144823198 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 6-(hydroxymethyl)oxane-3,4-diol;methanol |
| SMILES | CO.OCC1CC(O)C(O)CO1 |
| InChI | InChI=1S/C6H12O4.CH4O/c7-2-4-1-5(8)6(9)3-10-4;1-2/h4-9H,1-3H2;2H,1H3 |
| InChIKey | PRZLCYMXTGMYPV-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |