About 6-(hydroxymethyl)oxane-3,4-diol;methanol
6-(hydroxymethyl)oxane-3,4-diol;methanol (PubChem CID 144823198) has the molecular formula C7H16O5
and a molecular weight of 180.20 g/mol. Its IUPAC name is 6-(hydroxymethyl)oxane-3,4-diol;methanol.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)oxane-3,4-diol;methanol |
| PubChem CID | 144823198 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 6-(hydroxymethyl)oxane-3,4-diol;methanol |
| SMILES | CO.OCC1CC(O)C(O)CO1 |
| InChI | InChI=1S/C6H12O4.CH4O/c7-2-4-1-5(8)6(9)3-10-4;1-2/h4-9H,1-3H2;2H,1H3 |
| InChIKey | PRZLCYMXTGMYPV-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(hydroxymethyl)oxane-3,4-diol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)oxane-3,4-diol;methanol?
The IUPAC name of 6-(hydroxymethyl)oxane-3,4-diol;methanol (CID 144823198) is 6-(hydroxymethyl)oxane-3,4-diol;methanol.
What is the SMILES notation for 6-(hydroxymethyl)oxane-3,4-diol;methanol?
The canonical SMILES for 6-(hydroxymethyl)oxane-3,4-diol;methanol is CO.OCC1CC(O)C(O)CO1.
What is the InChIKey of 6-(hydroxymethyl)oxane-3,4-diol;methanol?
The InChIKey is PRZLCYMXTGMYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4.CH4O/c7-2-4-1-5(8)6(9)3-10-4;1-2/h4-9H,1-3H2;2H,1H3.
What are the key properties of 6-(hydroxymethyl)oxane-3,4-diol;methanol?
6-(hydroxymethyl)oxane-3,4-diol;methanol has a molecular weight of 180.20 g/mol, XLogP of -1.90, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)oxane-3,4-diol;methanol is sourced from PubChem (CID 144823198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).