C24H38N4O11 — CID 144823213
(2,5-dioxopyrrolidin-1-yl) 6-[[1-(2-hydroxyethylamino)-4-[2-[(2R,3S,6S)-3-hydroxy-6-methyloxan-2-yl]oxyethylamino]-1,4-dioxobutan-2-yl]amino]-6-oxohexanoate (PubChem CID 144823213) has the molecular formula C24H38N4O11 and a molecular weight of 558.59 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[1-(2-hydroxyethylamino)-4-[2-[(2R,3S,6S)-3-hydroxy-6-methyloxan-2-yl]oxyethylamino]-1,4-dioxobutan-2-yl]amino]-6-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[1-(2-hydroxyethylamino)-4-[2-[(2R,3S,6S)-3-hydroxy-6-methyloxan-2-yl]oxyethylamino]-1,4-dioxobutan-2-yl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 144823213 |
| Molecular Formula | C24H38N4O11 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[1-(2-hydroxyethylamino)-4-[2-[(2R,3S,6S)-3-hydroxy-6-methyloxan-2-yl]oxyethylamino]-1,4-dioxobutan-2-yl]amino]-6-oxohexanoate |
| SMILES | C[C@H]1CC[C@H](O)[C@H](OCCNC(=O)CC(NC(=O)CCCCC(=O)ON2C(=O)CCC2=O)C(=O)NCCO)O1 |
| InChI | InChI=1S/C24H38N4O11/c1-15-6-7-17(30)24(38-15)37-13-11-25-19(32)14-16(23(36)26-10-12-29)27-18(31)4-2-3-5-22(35)39-28-20(33)8-9-21(28)34/h15-17,24,29-30H,2-14H2,1H3,(H,25,32)(H,26,36)(H,27,31)/t15-,16?,17-,24+/m0/s1 |
| InChIKey | JGJOIIDLXOQKAX-ZIWCROFMSA-N |
| XLogP | -1.84 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|