About 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one
5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one (PubChem CID 144823510) has the molecular formula C11H15NO5
and a molecular weight of 241.24 g/mol. Its IUPAC name is 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one |
| PubChem CID | 144823510 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one |
| SMILES | COC1C(O)[C@@H](CO)O[C@H]1c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C11H15NO5/c1-16-11-9(15)7(5-13)17-10(11)6-2-3-8(14)12-4-6/h2-4,7,9-11,13,15H,5H2,1H3,(H,12,14)/t7-,9?,10+,11?/m1/s1 |
| InChIKey | HAVPOOBAAPCKQY-YJVKZPBASA-N |
| XLogP | -0.82 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one?
The IUPAC name of 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one (CID 144823510) is 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one.
What is the SMILES notation for 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one?
The canonical SMILES for 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one is COC1C(O)[C@@H](CO)O[C@H]1c1ccc(=O)[nH]c1.
What is the InChIKey of 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one?
The InChIKey is HAVPOOBAAPCKQY-YJVKZPBASA-N. The full InChI is InChI=1S/C11H15NO5/c1-16-11-9(15)7(5-13)17-10(11)6-2-3-8(14)12-4-6/h2-4,7,9-11,13,15H,5H2,1H3,(H,12,14)/t7-,9?,10+,11?/m1/s1.
What are the key properties of 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one?
5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one has a molecular weight of 241.24 g/mol, XLogP of -0.82, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-1H-pyridin-2-one is sourced from PubChem (CID 144823510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).